C14H10O6 — CID 171936005
1,2,4-trihydroxy-9-methoxybenzo[c]chromen-6-one (PubChem CID 171936005) has the molecular formula C14H10O6 and a molecular weight of 274.23 g/mol. Its IUPAC name is 1,2,4-trihydroxy-9-methoxybenzo[c]chromen-6-one.
| Compound Name | 1,2,4-trihydroxy-9-methoxybenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 171936005 |
| Molecular Formula | C14H10O6 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 1,2,4-trihydroxy-9-methoxybenzo[c]chromen-6-one |
| SMILES | COc1ccc2c(=O)oc3c(O)cc(O)c(O)c3c2c1 |
| InChI | InChI=1S/C14H10O6/c1-19-6-2-3-7-8(4-6)11-12(17)9(15)5-10(16)13(11)20-14(7)18/h2-5,15-17H,1H3 |
| InChIKey | BZJOBWWMZYYWRL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|