C13H23N3O4 — CID 63136602
1-[2-(2-acetamidoethylamino)-2-oxoethyl]-3-methylpiperidine-3-carboxylic acid (PubChem CID 63136602) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is 1-[2-(2-acetamidoethylamino)-2-oxoethyl]-3-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[2-(2-acetamidoethylamino)-2-oxoethyl]-3-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63136602 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-[2-(2-acetamidoethylamino)-2-oxoethyl]-3-methylpiperidine-3-carboxylic acid |
| SMILES | CC(=O)NCCNC(=O)CN1CCCC(C)(C(=O)O)C1 |
| InChI | InChI=1S/C13H23N3O4/c1-10(17)14-5-6-15-11(18)8-16-7-3-4-13(2,9-16)12(19)20/h3-9H2,1-2H3,(H,14,17)(H,15,18)(H,19,20) |
| InChIKey | PLDBTPQLRJKJQX-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|