About 3-methyl-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylic acid
3-methyl-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylic acid (PubChem CID 63137246) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-methyl-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylic acid.
Analyze 3-methyl-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylic acid?
The IUPAC name of 3-methyl-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylic acid (CID 63137246) is 3-methyl-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylic acid.
What is the SMILES notation for 3-methyl-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylic acid?
The canonical SMILES for 3-methyl-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylic acid is CC1(C(=O)O)CCCN(Cc2ccno2)C1.
What is the InChIKey of 3-methyl-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylic acid?
The InChIKey is SRUTXGVZRMHRSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-11(10(14)15)4-2-6-13(8-11)7-9-3-5-12-16-9/h3,5H,2,4,6-8H2,1H3,(H,14,15).
What are the key properties of 3-methyl-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylic acid?
3-methyl-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylic acid has a molecular weight of 224.26 g/mol, XLogP of 1.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 63137246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).