C12H16N2O5 — CID 63137556
3-methyl-1-[(5-nitrofuran-2-yl)methyl]piperidine-3-carboxylic acid (PubChem CID 63137556) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 3-methyl-1-[(5-nitrofuran-2-yl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 3-methyl-1-[(5-nitrofuran-2-yl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63137556 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3-methyl-1-[(5-nitrofuran-2-yl)methyl]piperidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCN(Cc2ccc([N+](=O)[O-])o2)C1 |
| InChI | InChI=1S/C12H16N2O5/c1-12(11(15)16)5-2-6-13(8-12)7-9-3-4-10(19-9)14(17)18/h3-4H,2,5-8H2,1H3,(H,15,16) |
| InChIKey | BGVXZASQBDVOBV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 96.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|