C10H12N2O5 — CID 63031711
1-[(5-nitrofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid (PubChem CID 63031711) has the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. Its IUPAC name is 1-[(5-nitrofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[(5-nitrofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63031711 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-[(5-nitrofuran-2-yl)methyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(Cc2ccc([N+](=O)[O-])o2)C1 |
| InChI | InChI=1S/C10H12N2O5/c13-10(14)7-3-4-11(5-7)6-8-1-2-9(17-8)12(15)16/h1-2,7H,3-6H2,(H,13,14) |
| InChIKey | OFLVFRRFJXLVOQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 96.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|