C16H32N2 — CID 63157462
2-(8-azaspiro[4.5]decan-8-yl)-2,4-dimethylpentan-1-amine (PubChem CID 63157462) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 2-(8-azaspiro[4.5]decan-8-yl)-2,4-dimethylpentan-1-amine.
| Compound Name | 2-(8-azaspiro[4.5]decan-8-yl)-2,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 63157462 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 2-(8-azaspiro[4.5]decan-8-yl)-2,4-dimethylpentan-1-amine |
| SMILES | CC(C)CC(C)(CN)N1CCC2(CCCC2)CC1 |
| InChI | InChI=1S/C16H32N2/c1-14(2)12-15(3,13-17)18-10-8-16(9-11-18)6-4-5-7-16/h14H,4-13,17H2,1-3H3 |
| InChIKey | HSFBAVZBZLWMPR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |