About 2-(4,4-dimethylpiperidin-1-yl)-2,5-dimethylhexan-1-amine
2-(4,4-dimethylpiperidin-1-yl)-2,5-dimethylhexan-1-amine (PubChem CID 55157653) has the molecular formula C15H32N2
and a molecular weight of 240.43 g/mol. Its IUPAC name is 2-(4,4-dimethylpiperidin-1-yl)-2,5-dimethylhexan-1-amine.
Molecular Properties
| Compound Name | 2-(4,4-dimethylpiperidin-1-yl)-2,5-dimethylhexan-1-amine |
| PubChem CID | 55157653 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | 2-(4,4-dimethylpiperidin-1-yl)-2,5-dimethylhexan-1-amine |
| SMILES | CC(C)CCC(C)(CN)N1CCC(C)(C)CC1 |
| InChI | InChI=1S/C15H32N2/c1-13(2)6-7-15(5,12-16)17-10-8-14(3,4)9-11-17/h13H,6-12,16H2,1-5H3 |
| InChIKey | LYDFKRRMLFIMIY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4,4-dimethylpiperidin-1-yl)-2,5-dimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethylpiperidin-1-yl)-2,5-dimethylhexan-1-amine?
The IUPAC name of 2-(4,4-dimethylpiperidin-1-yl)-2,5-dimethylhexan-1-amine (CID 55157653) is 2-(4,4-dimethylpiperidin-1-yl)-2,5-dimethylhexan-1-amine.
What is the SMILES notation for 2-(4,4-dimethylpiperidin-1-yl)-2,5-dimethylhexan-1-amine?
The canonical SMILES for 2-(4,4-dimethylpiperidin-1-yl)-2,5-dimethylhexan-1-amine is CC(C)CCC(C)(CN)N1CCC(C)(C)CC1.
What is the InChIKey of 2-(4,4-dimethylpiperidin-1-yl)-2,5-dimethylhexan-1-amine?
The InChIKey is LYDFKRRMLFIMIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2/c1-13(2)6-7-15(5,12-16)17-10-8-14(3,4)9-11-17/h13H,6-12,16H2,1-5H3.
What are the key properties of 2-(4,4-dimethylpiperidin-1-yl)-2,5-dimethylhexan-1-amine?
2-(4,4-dimethylpiperidin-1-yl)-2,5-dimethylhexan-1-amine has a molecular weight of 240.43 g/mol, XLogP of 3.26, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethylpiperidin-1-yl)-2,5-dimethylhexan-1-amine is sourced from PubChem (CID 55157653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).