C13H9F2N3O3 — CID 63157578
5-[(2,3-difluorophenyl)carbamoylamino]pyridine-3-carboxylic acid (PubChem CID 63157578) has the molecular formula C13H9F2N3O3 and a molecular weight of 293.23 g/mol. Its IUPAC name is 5-[(2,3-difluorophenyl)carbamoylamino]pyridine-3-carboxylic acid.
| Compound Name | 5-[(2,3-difluorophenyl)carbamoylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63157578 |
| Molecular Formula | C13H9F2N3O3 |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 5-[(2,3-difluorophenyl)carbamoylamino]pyridine-3-carboxylic acid |
| SMILES | O=C(Nc1cncc(C(=O)O)c1)Nc1cccc(F)c1F |
| InChI | InChI=1S/C13H9F2N3O3/c14-9-2-1-3-10(11(9)15)18-13(21)17-8-4-7(12(19)20)5-16-6-8/h1-6H,(H,19,20)(H2,17,18,21) |
| InChIKey | WCAOMEXGYOLNNO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |