C12H26N2 — CID 63158111
6-methyl-N,N-dipropylpiperidin-3-amine (PubChem CID 63158111) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is 6-methyl-N,N-dipropylpiperidin-3-amine.
| Compound Name | 6-methyl-N,N-dipropylpiperidin-3-amine |
|---|---|
| PubChem CID | 63158111 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 6-methyl-N,N-dipropylpiperidin-3-amine |
| SMILES | CCCN(CCC)C1CCC(C)NC1 |
| InChI | InChI=1S/C12H26N2/c1-4-8-14(9-5-2)12-7-6-11(3)13-10-12/h11-13H,4-10H2,1-3H3 |
| InChIKey | YNNXCUAXQXSZIF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |