methyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate

C14H28N2O2 — CID 63159456

IUPACmethyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate
SMILESCCC1(CC)CCN(CC(NC)C(=O)OC)CC1
InChIInChI=1S/C14H28N2O2/c1-5-14(6-2)7-9-16(10-8-14)11-12(15-3)13(17)18-4/h12,15H,5-11H2,1-4H3
InChIKeyKTEHJFHFPPQCQU-UHFFFAOYSA-N
MW256.39 g/mol
LogP1.65
Rot. Bonds6

About methyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate

methyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate (PubChem CID 63159456) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is methyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate.

Molecular Properties

Compound Namemethyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate
PubChem CID63159456
Molecular FormulaC14H28N2O2
Molecular Weight256.39 g/mol
Exact Mass256.22
IUPAC Namemethyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate
SMILESCCC1(CC)CCN(CC(NC)C(=O)OC)CC1
InChIInChI=1S/C14H28N2O2/c1-5-14(6-2)7-9-16(10-8-14)11-12(15-3)13(17)18-4/h12,15H,5-11H2,1-4H3
InChIKeyKTEHJFHFPPQCQU-UHFFFAOYSA-N
XLogP1.65
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.39
LogP ≤ 51.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate?
The IUPAC name of methyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate (CID 63159456) is methyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate.
What is the SMILES notation for methyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate?
The canonical SMILES for methyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate is CCC1(CC)CCN(CC(NC)C(=O)OC)CC1.
What is the InChIKey of methyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate?
The InChIKey is KTEHJFHFPPQCQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O2/c1-5-14(6-2)7-9-16(10-8-14)11-12(15-3)13(17)18-4/h12,15H,5-11H2,1-4H3.
What are the key properties of methyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate?
methyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate has a molecular weight of 256.39 g/mol, XLogP of 1.65, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4,4-diethylpiperidin-1-yl)-2-(methylamino)propanoate is sourced from PubChem (CID 63159456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).