C8H14N2O3S — CID 63166471
3-(3-hydroxypropylamino)-1,1-dioxothiolane-3-carbonitrile (PubChem CID 63166471) has the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. Its IUPAC name is 3-(3-hydroxypropylamino)-1,1-dioxothiolane-3-carbonitrile.
| Compound Name | 3-(3-hydroxypropylamino)-1,1-dioxothiolane-3-carbonitrile |
|---|---|
| PubChem CID | 63166471 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 3-(3-hydroxypropylamino)-1,1-dioxothiolane-3-carbonitrile |
| SMILES | N#CC1(NCCCO)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14N2O3S/c9-6-8(10-3-1-4-11)2-5-14(12,13)7-8/h10-11H,1-5,7H2 |
| InChIKey | OJDFYNDLQXEINJ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|