C16H21FN2O2 — CID 63170090
1-(5-fluoro-2-hydroxyphenyl)-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)ethanone (PubChem CID 63170090) has the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. Its IUPAC name is 1-(5-fluoro-2-hydroxyphenyl)-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)ethanone.
| Compound Name | 1-(5-fluoro-2-hydroxyphenyl)-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 63170090 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1-(5-fluoro-2-hydroxyphenyl)-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)ethanone |
| SMILES | O=C(CN1CCC(N2CCCC2)C1)c1cc(F)ccc1O |
| InChI | InChI=1S/C16H21FN2O2/c17-12-3-4-15(20)14(9-12)16(21)11-18-8-5-13(10-18)19-6-1-2-7-19/h3-4,9,13,20H,1-2,5-8,10-11H2 |
| InChIKey | IPPRGQQDGVBWEU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |