C9H15N3O — CID 63175546
2-[[amino(cyclopropyl)methylidene]amino]-N-cyclopropylacetamide (PubChem CID 63175546) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-[[amino(cyclopropyl)methylidene]amino]-N-cyclopropylacetamide.
| Compound Name | 2-[[amino(cyclopropyl)methylidene]amino]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 63175546 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 2-[[amino(cyclopropyl)methylidene]amino]-N-cyclopropylacetamide |
| SMILES | N/C(=N\CC(=O)NC1CC1)C1CC1 |
| InChI | InChI=1S/C9H15N3O/c10-9(6-1-2-6)11-5-8(13)12-7-3-4-7/h6-7H,1-5H2,(H2,10,11)(H,12,13) |
| InChIKey | ASWPDZFXUBFRIR-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|