C9H17N3O — CID 63175544
2-(1-aminobutylideneamino)-N-cyclopropylacetamide (PubChem CID 63175544) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-(1-aminobutylideneamino)-N-cyclopropylacetamide.
| Compound Name | 2-(1-aminobutylideneamino)-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 63175544 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 2-(1-aminobutylideneamino)-N-cyclopropylacetamide |
| SMILES | CCC/C(N)=N\CC(=O)NC1CC1 |
| InChI | InChI=1S/C9H17N3O/c1-2-3-8(10)11-6-9(13)12-7-4-5-7/h7H,2-6H2,1H3,(H2,10,11)(H,12,13) |
| InChIKey | SFCZXJPGDCHDPL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|