C13H22N2O — CID 63176563
3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl(cyclopentyl)methanimine (PubChem CID 63176563) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl(cyclopentyl)methanimine.
| Compound Name | 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl(cyclopentyl)methanimine |
|---|---|
| PubChem CID | 63176563 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl(cyclopentyl)methanimine |
| SMILES | [H]/N=C(\C1CCCC1)N1CCOC2CCCC21 |
| InChI | InChI=1S/C13H22N2O/c14-13(10-4-1-2-5-10)15-8-9-16-12-7-3-6-11(12)15/h10-12,14H,1-9H2/b14-13+ |
| InChIKey | YXNCTJSSUYGFKB-BUHFOSPRSA-N |
| XLogP | 2.41 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|