C13H22N2 — CID 63175923
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl(cyclopropyl)methanimine (PubChem CID 63175923) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl(cyclopropyl)methanimine.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl(cyclopropyl)methanimine |
|---|---|
| PubChem CID | 63175923 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl(cyclopropyl)methanimine |
| SMILES | [H]/N=C(\C1CC1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C13H22N2/c14-13(11-7-8-11)15-9-3-5-10-4-1-2-6-12(10)15/h10-12,14H,1-9H2/b14-13+ |
| InChIKey | YTJYKNVIVVPNTE-BUHFOSPRSA-N |
| XLogP | 3.03 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|