C19H29NO — CID 97015732
1-[(2R)-2-cyclohexylpyrrolidin-1-yl]-3,3-dicyclopropylprop-2-en-1-one (PubChem CID 97015732) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-[(2R)-2-cyclohexylpyrrolidin-1-yl]-3,3-dicyclopropylprop-2-en-1-one.
| Compound Name | 1-[(2R)-2-cyclohexylpyrrolidin-1-yl]-3,3-dicyclopropylprop-2-en-1-one |
|---|---|
| PubChem CID | 97015732 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 1-[(2R)-2-cyclohexylpyrrolidin-1-yl]-3,3-dicyclopropylprop-2-en-1-one |
| SMILES | O=C(C=C(C1CC1)C1CC1)N1CCC[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C19H29NO/c21-19(13-17(14-8-9-14)15-10-11-15)20-12-4-7-18(20)16-5-2-1-3-6-16/h13-16,18H,1-12H2/t18-/m1/s1 |
| InChIKey | CVDLSYRNYUHWER-GOSISDBHSA-N |
| XLogP | 4.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|