C14H28N2 — CID 63176962
N-(3,3-dimethylbutan-2-yl)-N-methylcyclohexanecarboximidamide (PubChem CID 63176962) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-N-methylcyclohexanecarboximidamide.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-N-methylcyclohexanecarboximidamide |
|---|---|
| PubChem CID | 63176962 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-N-methylcyclohexanecarboximidamide |
| SMILES | [H]/N=C(/C1CCCCC1)N(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C14H28N2/c1-11(14(2,3)4)16(5)13(15)12-9-7-6-8-10-12/h11-12,15H,6-10H2,1-5H3/b15-13- |
| InChIKey | NNPZFEDBCZKLEH-SQFISAMPSA-N |
| XLogP | 3.91 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|