C16H23FN2 — CID 63181963
N-[1-(2-fluorophenyl)ethyl]-N-methylcyclohexanecarboximidamide (PubChem CID 63181963) has the molecular formula C16H23FN2 and a molecular weight of 262.37 g/mol. Its IUPAC name is N-[1-(2-fluorophenyl)ethyl]-N-methylcyclohexanecarboximidamide.
| Compound Name | N-[1-(2-fluorophenyl)ethyl]-N-methylcyclohexanecarboximidamide |
|---|---|
| PubChem CID | 63181963 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | N-[1-(2-fluorophenyl)ethyl]-N-methylcyclohexanecarboximidamide |
| SMILES | [H]/N=C(\C1CCCCC1)N(C)C(C)c1ccccc1F |
| InChI | InChI=1S/C16H23FN2/c1-12(14-10-6-7-11-15(14)17)19(2)16(18)13-8-4-3-5-9-13/h6-7,10-13,18H,3-5,8-9H2,1-2H3/b18-16+ |
| InChIKey | DIJDHMQVLJSQBL-FBMGVBCBSA-N |
| XLogP | 4.38 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|