C24H32FN3O — CID 55816833
3-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-1-[1-(2-fluorophenyl)ethyl]-1-methylurea (PubChem CID 55816833) has the molecular formula C24H32FN3O and a molecular weight of 397.54 g/mol. Its IUPAC name is 3-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-1-[1-(2-fluorophenyl)ethyl]-1-methylurea.
| Compound Name | 3-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-1-[1-(2-fluorophenyl)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 55816833 |
| Molecular Formula | C24H32FN3O |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 3-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-1-[1-(2-fluorophenyl)ethyl]-1-methylurea |
| SMILES | CC(c1ccccc1F)N(C)C(=O)Nc1ccccc1CN(C)C1CCCCC1 |
| InChI | InChI=1S/C24H32FN3O/c1-18(21-14-8-9-15-22(21)25)28(3)24(29)26-23-16-10-7-11-19(23)17-27(2)20-12-5-4-6-13-20/h7-11,14-16,18,20H,4-6,12-13,17H2,1-3H3,(H,26,29) |
| InChIKey | INNFYMNXNCQRPB-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |