C24H32N4O3 — CID 47032536
3-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-1-methyl-1-[1-(3-nitrophenyl)ethyl]urea (PubChem CID 47032536) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is 3-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-1-methyl-1-[1-(3-nitrophenyl)ethyl]urea.
| Compound Name | 3-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-1-methyl-1-[1-(3-nitrophenyl)ethyl]urea |
|---|---|
| PubChem CID | 47032536 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 3-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-1-methyl-1-[1-(3-nitrophenyl)ethyl]urea |
| SMILES | CC(c1cccc([N+](=O)[O-])c1)N(C)C(=O)Nc1ccccc1CN(C)C1CCCCC1 |
| InChI | InChI=1S/C24H32N4O3/c1-18(19-11-9-14-22(16-19)28(30)31)27(3)24(29)25-23-15-8-7-10-20(23)17-26(2)21-12-5-4-6-13-21/h7-11,14-16,18,21H,4-6,12-13,17H2,1-3H3,(H,25,29) |
| InChIKey | NFMIJICCFRWOOZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|