C17H25N3O2S — CID 8561058
1-methyl-3-[(1S,2S)-2-methylcyclohexyl]-1-[(1S)-1-(3-nitrophenyl)ethyl]thiourea (PubChem CID 8561058) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is 1-methyl-3-[(1S,2S)-2-methylcyclohexyl]-1-[(1S)-1-(3-nitrophenyl)ethyl]thiourea.
| Compound Name | 1-methyl-3-[(1S,2S)-2-methylcyclohexyl]-1-[(1S)-1-(3-nitrophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 8561058 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-methyl-3-[(1S,2S)-2-methylcyclohexyl]-1-[(1S)-1-(3-nitrophenyl)ethyl]thiourea |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=S)N(C)[C@@H](C)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H25N3O2S/c1-12-7-4-5-10-16(12)18-17(23)19(3)13(2)14-8-6-9-15(11-14)20(21)22/h6,8-9,11-13,16H,4-5,7,10H2,1-3H3,(H,18,23)/t12-,13-,16-/m0/s1 |
| InChIKey | KDSIQSLETMJMPU-XEZPLFJOSA-N |
| XLogP | 4.04 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|