C20H25N5O3S — CID 9095081
1-cyclopropyl-3-[(1S,2S)-2-methylcyclohexyl]-1-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]thiourea (PubChem CID 9095081) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(1S,2S)-2-methylcyclohexyl]-1-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[(1S,2S)-2-methylcyclohexyl]-1-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 9095081 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 1-cyclopropyl-3-[(1S,2S)-2-methylcyclohexyl]-1-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]thiourea |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=S)N(Cc1nnc(-c2cccc([N+](=O)[O-])c2)o1)C1CC1 |
| InChI | InChI=1S/C20H25N5O3S/c1-13-5-2-3-8-17(13)21-20(29)24(15-9-10-15)12-18-22-23-19(28-18)14-6-4-7-16(11-14)25(26)27/h4,6-7,11,13,15,17H,2-3,5,8-10,12H2,1H3,(H,21,29)/t13-,17-/m0/s1 |
| InChIKey | GGQRGFSQIKGBPB-GUYCJALGSA-N |
| XLogP | 4.06 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|