C23H20ClN5O5 — CID 42905775
1-(2-chlorophenyl)-N-cyclopropyl-N-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 42905775) has the molecular formula C23H20ClN5O5 and a molecular weight of 481.90 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-cyclopropyl-N-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-cyclopropyl-N-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42905775 |
| Molecular Formula | C23H20ClN5O5 |
| Molecular Weight | 481.90 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 1-(2-chlorophenyl)-N-cyclopropyl-N-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C1CC(C(=O)N(Cc2nnc(-c3cccc([N+](=O)[O-])c3)o2)C2CC2)CN1c1ccccc1Cl |
| InChI | InChI=1S/C23H20ClN5O5/c24-18-6-1-2-7-19(18)28-12-15(11-21(28)30)23(31)27(16-8-9-16)13-20-25-26-22(34-20)14-4-3-5-17(10-14)29(32)33/h1-7,10,15-16H,8-9,11-13H2 |
| InChIKey | QBLBCEROMPBZPH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 122.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.90 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|