C14H23N4O2S+ — CID 8560931
dimethyl-[2-[[methyl-[(1R)-1-(3-nitrophenyl)ethyl]carbamothioyl]amino]ethyl]azanium (PubChem CID 8560931) has the molecular formula C14H23N4O2S+ and a molecular weight of 311.43 g/mol. Its IUPAC name is dimethyl-[2-[[methyl-[(1R)-1-(3-nitrophenyl)ethyl]carbamothioyl]amino]ethyl]azanium.
| Compound Name | dimethyl-[2-[[methyl-[(1R)-1-(3-nitrophenyl)ethyl]carbamothioyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 8560931 |
| Molecular Formula | C14H23N4O2S+ |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | dimethyl-[2-[[methyl-[(1R)-1-(3-nitrophenyl)ethyl]carbamothioyl]amino]ethyl]azanium |
| SMILES | C[C@H](c1cccc([N+](=O)[O-])c1)N(C)C(=S)NCC[NH+](C)C |
| InChI | InChI=1S/C14H22N4O2S/c1-11(12-6-5-7-13(10-12)18(19)20)17(4)14(21)15-8-9-16(2)3/h5-7,10-11H,8-9H2,1-4H3,(H,15,21)/p+1/t11-/m1/s1 |
| InChIKey | TYHBDSFGJIUQAR-LLVKDONJSA-O |
| XLogP | 0.61 |
| TPSA | 62.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|