C17H25N3O4S — CID 8561073
methyl 6-[[methyl-[(1R)-1-(3-nitrophenyl)ethyl]carbamothioyl]amino]hexanoate (PubChem CID 8561073) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is methyl 6-[[methyl-[(1R)-1-(3-nitrophenyl)ethyl]carbamothioyl]amino]hexanoate.
| Compound Name | methyl 6-[[methyl-[(1R)-1-(3-nitrophenyl)ethyl]carbamothioyl]amino]hexanoate |
|---|---|
| PubChem CID | 8561073 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | methyl 6-[[methyl-[(1R)-1-(3-nitrophenyl)ethyl]carbamothioyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=S)N(C)[C@H](C)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H25N3O4S/c1-13(14-8-7-9-15(12-14)20(22)23)19(2)17(25)18-11-6-4-5-10-16(21)24-3/h7-9,12-13H,4-6,10-11H2,1-3H3,(H,18,25)/t13-/m1/s1 |
| InChIKey | VVSBEHNITQAZQD-CYBMUJFWSA-N |
| XLogP | 3.20 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|