C16H19F2N3 — CID 63181107
2-(difluoromethyl)-N-methyl-6-piperidin-1-ylquinolin-4-amine (PubChem CID 63181107) has the molecular formula C16H19F2N3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-methyl-6-piperidin-1-ylquinolin-4-amine.
| Compound Name | 2-(difluoromethyl)-N-methyl-6-piperidin-1-ylquinolin-4-amine |
|---|---|
| PubChem CID | 63181107 |
| Molecular Formula | C16H19F2N3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-(difluoromethyl)-N-methyl-6-piperidin-1-ylquinolin-4-amine |
| SMILES | CNc1cc(C(F)F)nc2ccc(N3CCCCC3)cc12 |
| InChI | InChI=1S/C16H19F2N3/c1-19-14-10-15(16(17)18)20-13-6-5-11(9-12(13)14)21-7-3-2-4-8-21/h5-6,9-10,16H,2-4,7-8H2,1H3,(H,19,20) |
| InChIKey | CNFTZJJKAKMHJJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |