C11H17N3 — CID 63181666
3-methyl-N'-(2-methylpropyl)pyridine-2-carboximidamide (PubChem CID 63181666) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 3-methyl-N'-(2-methylpropyl)pyridine-2-carboximidamide.
| Compound Name | 3-methyl-N'-(2-methylpropyl)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 63181666 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 3-methyl-N'-(2-methylpropyl)pyridine-2-carboximidamide |
| SMILES | Cc1cccnc1/C(N)=N/CC(C)C |
| InChI | InChI=1S/C11H17N3/c1-8(2)7-14-11(12)10-9(3)5-4-6-13-10/h4-6,8H,7H2,1-3H3,(H2,12,14) |
| InChIKey | UVUTZTITHNQTKH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|