C9H14N2OS — CID 63181895
N'-(2-methoxyethyl)-2-thiophen-2-ylethanimidamide (PubChem CID 63181895) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-2-thiophen-2-ylethanimidamide.
| Compound Name | N'-(2-methoxyethyl)-2-thiophen-2-ylethanimidamide |
|---|---|
| PubChem CID | 63181895 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | N'-(2-methoxyethyl)-2-thiophen-2-ylethanimidamide |
| SMILES | COCC/N=C(\N)Cc1cccs1 |
| InChI | InChI=1S/C9H14N2OS/c1-12-5-4-11-9(10)7-8-3-2-6-13-8/h2-3,6H,4-5,7H2,1H3,(H2,10,11) |
| InChIKey | FMUOCTBOQKJIBE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|