C16H29IN4O2S — CID 75423246
3-[[N'-(2-methoxyethyl)-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide (PubChem CID 75423246) has the molecular formula C16H29IN4O2S and a molecular weight of 468.41 g/mol. Its IUPAC name is 3-[[N'-(2-methoxyethyl)-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide.
| Compound Name | 3-[[N'-(2-methoxyethyl)-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 75423246 |
| Molecular Formula | C16H29IN4O2S |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 3-[[N'-(2-methoxyethyl)-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide |
| SMILES | COCC/N=C(\NCCC(=O)NC(C)C)NCCc1cccs1.I |
| InChI | InChI=1S/C16H28N4O2S.HI/c1-13(2)20-15(21)7-9-18-16(19-10-11-22-3)17-8-6-14-5-4-12-23-14;/h4-5,12-13H,6-11H2,1-3H3,(H,20,21)(H2,17,18,19);1H |
| InChIKey | IGCVXRLMPRUHAD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|