C30H28N4O6 — CID 6318250
(4E)-4-[hydroxy-(5-methyl-1-phenylpyrazol-4-yl)methylidene]-1-(pyridin-3-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6318250) has the molecular formula C30H28N4O6 and a molecular weight of 540.58 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(5-methyl-1-phenylpyrazol-4-yl)methylidene]-1-(pyridin-3-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(5-methyl-1-phenylpyrazol-4-yl)methylidene]-1-(pyridin-3-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6318250 |
| Molecular Formula | C30H28N4O6 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | (4E)-4-[hydroxy-(5-methyl-1-phenylpyrazol-4-yl)methylidene]-1-(pyridin-3-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2/C(=C(\O)c3cnn(-c4ccccc4)c3C)C(=O)C(=O)N2Cc2cccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C30H28N4O6/c1-18-22(16-32-34(18)21-10-6-5-7-11-21)27(35)25-26(20-13-23(38-2)29(40-4)24(14-20)39-3)33(30(37)28(25)36)17-19-9-8-12-31-15-19/h5-16,26,35H,17H2,1-4H3/b27-25+ |
| InChIKey | WRIHHRWKYFOEFK-IMVLJIQESA-N |
| XLogP | 4.22 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|