C14H10F2O4 — CID 63183962
3,5-difluoro-4-[3-(hydroxymethyl)phenoxy]benzoic acid (PubChem CID 63183962) has the molecular formula C14H10F2O4 and a molecular weight of 280.23 g/mol. Its IUPAC name is 3,5-difluoro-4-[3-(hydroxymethyl)phenoxy]benzoic acid.
| Compound Name | 3,5-difluoro-4-[3-(hydroxymethyl)phenoxy]benzoic acid |
|---|---|
| PubChem CID | 63183962 |
| Molecular Formula | C14H10F2O4 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 3,5-difluoro-4-[3-(hydroxymethyl)phenoxy]benzoic acid |
| SMILES | O=C(O)c1cc(F)c(Oc2cccc(CO)c2)c(F)c1 |
| InChI | InChI=1S/C14H10F2O4/c15-11-5-9(14(18)19)6-12(16)13(11)20-10-3-1-2-8(4-10)7-17/h1-6,17H,7H2,(H,18,19) |
| InChIKey | ZRYIFZZOKLHKJG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |