C15H9F2NO3 — CID 63077037
4-[4-(cyanomethyl)phenoxy]-3,5-difluorobenzoic acid (PubChem CID 63077037) has the molecular formula C15H9F2NO3 and a molecular weight of 289.24 g/mol. Its IUPAC name is 4-[4-(cyanomethyl)phenoxy]-3,5-difluorobenzoic acid.
| Compound Name | 4-[4-(cyanomethyl)phenoxy]-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 63077037 |
| Molecular Formula | C15H9F2NO3 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 4-[4-(cyanomethyl)phenoxy]-3,5-difluorobenzoic acid |
| SMILES | N#CCc1ccc(Oc2c(F)cc(C(=O)O)cc2F)cc1 |
| InChI | InChI=1S/C15H9F2NO3/c16-12-7-10(15(19)20)8-13(17)14(12)21-11-3-1-9(2-4-11)5-6-18/h1-4,7-8H,5H2,(H,19,20) |
| InChIKey | HYMCCXIQANBHRT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |