C10H8F2N4O2 — CID 63186618
3,5-difluoro-4-hydrazinyl-N-(1,2-oxazol-4-yl)benzamide (PubChem CID 63186618) has the molecular formula C10H8F2N4O2 and a molecular weight of 254.20 g/mol. Its IUPAC name is 3,5-difluoro-4-hydrazinyl-N-(1,2-oxazol-4-yl)benzamide.
| Compound Name | 3,5-difluoro-4-hydrazinyl-N-(1,2-oxazol-4-yl)benzamide |
|---|---|
| PubChem CID | 63186618 |
| Molecular Formula | C10H8F2N4O2 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 3,5-difluoro-4-hydrazinyl-N-(1,2-oxazol-4-yl)benzamide |
| SMILES | NNc1c(F)cc(C(=O)Nc2cnoc2)cc1F |
| InChI | InChI=1S/C10H8F2N4O2/c11-7-1-5(2-8(12)9(7)16-13)10(17)15-6-3-14-18-4-6/h1-4,16H,13H2,(H,15,17) |
| InChIKey | MSXZNACUTKGHCS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|