C12H13F3N2O2 — CID 63188388
N-[2-(dimethylamino)-2-oxoethyl]-3,4,5-trifluoro-N-methylbenzamide (PubChem CID 63188388) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-oxoethyl]-3,4,5-trifluoro-N-methylbenzamide.
| Compound Name | N-[2-(dimethylamino)-2-oxoethyl]-3,4,5-trifluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 63188388 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N-[2-(dimethylamino)-2-oxoethyl]-3,4,5-trifluoro-N-methylbenzamide |
| SMILES | CN(C)C(=O)CN(C)C(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H13F3N2O2/c1-16(2)10(18)6-17(3)12(19)7-4-8(13)11(15)9(14)5-7/h4-5H,6H2,1-3H3 |
| InChIKey | ZCXUQYUPVCVBKI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|