C17H29NO2S — CID 63192548
2-methyl-6-methylsulfonyl-2-phenyl-N-propylhexan-3-amine (PubChem CID 63192548) has the molecular formula C17H29NO2S and a molecular weight of 311.49 g/mol. Its IUPAC name is 2-methyl-6-methylsulfonyl-2-phenyl-N-propylhexan-3-amine.
| Compound Name | 2-methyl-6-methylsulfonyl-2-phenyl-N-propylhexan-3-amine |
|---|---|
| PubChem CID | 63192548 |
| Molecular Formula | C17H29NO2S |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-methyl-6-methylsulfonyl-2-phenyl-N-propylhexan-3-amine |
| SMILES | CCCNC(CCCS(C)(=O)=O)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H29NO2S/c1-5-13-18-16(12-9-14-21(4,19)20)17(2,3)15-10-7-6-8-11-15/h6-8,10-11,16,18H,5,9,12-14H2,1-4H3 |
| InChIKey | YXNQJTJLLOJHBG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |