About N-tert-butyl-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butan-1-amine
N-tert-butyl-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butan-1-amine (PubChem CID 63193087) has the molecular formula C17H28N2O
and a molecular weight of 276.42 g/mol. Its IUPAC name is N-tert-butyl-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butan-1-amine |
| PubChem CID | 63193087 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N-tert-butyl-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butan-1-amine |
| SMILES | CC(CCNC(C)(C)C)N1CCOc2ccccc2C1 |
| InChI | InChI=1S/C17H28N2O/c1-14(9-10-18-17(2,3)4)19-11-12-20-16-8-6-5-7-15(16)13-19/h5-8,14,18H,9-13H2,1-4H3 |
| InChIKey | RSMKHDDXVPPQFH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butan-1-amine?
The IUPAC name of N-tert-butyl-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butan-1-amine (CID 63193087) is N-tert-butyl-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butan-1-amine.
What is the SMILES notation for N-tert-butyl-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butan-1-amine?
The canonical SMILES for N-tert-butyl-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butan-1-amine is CC(CCNC(C)(C)C)N1CCOc2ccccc2C1.
What is the InChIKey of N-tert-butyl-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butan-1-amine?
The InChIKey is RSMKHDDXVPPQFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O/c1-14(9-10-18-17(2,3)4)19-11-12-20-16-8-6-5-7-15(16)13-19/h5-8,14,18H,9-13H2,1-4H3.
What are the key properties of N-tert-butyl-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butan-1-amine?
N-tert-butyl-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butan-1-amine has a molecular weight of 276.42 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butan-1-amine is sourced from PubChem (CID 63193087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).