C14H19ClN2OS — CID 63194894
N-(3-amino-2-methyl-3-sulfanylidenepropyl)-3-chloro-N-ethyl-4-methylbenzamide (PubChem CID 63194894) has the molecular formula C14H19ClN2OS and a molecular weight of 298.84 g/mol. Its IUPAC name is N-(3-amino-2-methyl-3-sulfanylidenepropyl)-3-chloro-N-ethyl-4-methylbenzamide.
| Compound Name | N-(3-amino-2-methyl-3-sulfanylidenepropyl)-3-chloro-N-ethyl-4-methylbenzamide |
|---|---|
| PubChem CID | 63194894 |
| Molecular Formula | C14H19ClN2OS |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | N-(3-amino-2-methyl-3-sulfanylidenepropyl)-3-chloro-N-ethyl-4-methylbenzamide |
| SMILES | CCN(CC(C)C(N)=S)C(=O)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2OS/c1-4-17(8-10(3)13(16)19)14(18)11-6-5-9(2)12(15)7-11/h5-7,10H,4,8H2,1-3H3,(H2,16,19) |
| InChIKey | XGFNZKXAVZGKGA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|