C14H19BrO2S — CID 63195866
1-bromo-2-(3-methylsulfonylpropyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 63195866) has the molecular formula C14H19BrO2S and a molecular weight of 331.28 g/mol. Its IUPAC name is 1-bromo-2-(3-methylsulfonylpropyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-bromo-2-(3-methylsulfonylpropyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 63195866 |
| Molecular Formula | C14H19BrO2S |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 1-bromo-2-(3-methylsulfonylpropyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CS(=O)(=O)CCCC1CCc2ccccc2C1Br |
| InChI | InChI=1S/C14H19BrO2S/c1-18(16,17)10-4-6-12-9-8-11-5-2-3-7-13(11)14(12)15/h2-3,5,7,12,14H,4,6,8-10H2,1H3 |
| InChIKey | SDWMDFGBJHTBQH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|