C13H22N2O2S — CID 63202014
N,N-dimethyl-2-[2-(methylamino)butyl]benzenesulfonamide (PubChem CID 63202014) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-(methylamino)butyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-2-[2-(methylamino)butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63202014 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N,N-dimethyl-2-[2-(methylamino)butyl]benzenesulfonamide |
| SMILES | CCC(Cc1ccccc1S(=O)(=O)N(C)C)NC |
| InChI | InChI=1S/C13H22N2O2S/c1-5-12(14-2)10-11-8-6-7-9-13(11)18(16,17)15(3)4/h6-9,12,14H,5,10H2,1-4H3 |
| InChIKey | HFZNEXPFRHUHDX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |