C11H19N3 — CID 63202106
1-(3,6-dimethylpyrazin-2-yl)-N-methylbutan-2-amine (PubChem CID 63202106) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-(3,6-dimethylpyrazin-2-yl)-N-methylbutan-2-amine.
| Compound Name | 1-(3,6-dimethylpyrazin-2-yl)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 63202106 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1-(3,6-dimethylpyrazin-2-yl)-N-methylbutan-2-amine |
| SMILES | CCC(Cc1nc(C)cnc1C)NC |
| InChI | InChI=1S/C11H19N3/c1-5-10(12-4)6-11-9(3)13-7-8(2)14-11/h7,10,12H,5-6H2,1-4H3 |
| InChIKey | AXGMTFSFJHWSDK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |