C13H19N3O — CID 63215793
(2,4-diaminophenyl)-(2,2-dimethylpyrrolidin-1-yl)methanone (PubChem CID 63215793) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is (2,4-diaminophenyl)-(2,2-dimethylpyrrolidin-1-yl)methanone.
| Compound Name | (2,4-diaminophenyl)-(2,2-dimethylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 63215793 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | (2,4-diaminophenyl)-(2,2-dimethylpyrrolidin-1-yl)methanone |
| SMILES | CC1(C)CCCN1C(=O)c1ccc(N)cc1N |
| InChI | InChI=1S/C13H19N3O/c1-13(2)6-3-7-16(13)12(17)10-5-4-9(14)8-11(10)15/h4-5,8H,3,6-7,14-15H2,1-2H3 |
| InChIKey | NUPMBYMHIQXOBY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|