C13H17BN2O3 — CID 63216731
[4-(3-imidazol-1-ylpropoxy)-3-methylphenyl]boronic acid (PubChem CID 63216731) has the molecular formula C13H17BN2O3 and a molecular weight of 260.10 g/mol. Its IUPAC name is [4-(3-imidazol-1-ylpropoxy)-3-methylphenyl]boronic acid.
| Compound Name | [4-(3-imidazol-1-ylpropoxy)-3-methylphenyl]boronic acid |
|---|---|
| PubChem CID | 63216731 |
| Molecular Formula | C13H17BN2O3 |
| Molecular Weight | 260.10 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | [4-(3-imidazol-1-ylpropoxy)-3-methylphenyl]boronic acid |
| SMILES | Cc1cc(B(O)O)ccc1OCCCn1ccnc1 |
| InChI | InChI=1S/C13H17BN2O3/c1-11-9-12(14(17)18)3-4-13(11)19-8-2-6-16-7-5-15-10-16/h3-5,7,9-10,17-18H,2,6,8H2,1H3 |
| InChIKey | RYQJCFNOGDLYMT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.10 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|