C13H15ClN2O3S — CID 82917400
4-(3-imidazol-1-ylpropoxy)-3-methylbenzenesulfonyl chloride (PubChem CID 82917400) has the molecular formula C13H15ClN2O3S and a molecular weight of 314.79 g/mol. Its IUPAC name is 4-(3-imidazol-1-ylpropoxy)-3-methylbenzenesulfonyl chloride.
| Compound Name | 4-(3-imidazol-1-ylpropoxy)-3-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82917400 |
| Molecular Formula | C13H15ClN2O3S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 4-(3-imidazol-1-ylpropoxy)-3-methylbenzenesulfonyl chloride |
| SMILES | Cc1cc(S(=O)(=O)Cl)ccc1OCCCn1ccnc1 |
| InChI | InChI=1S/C13H15ClN2O3S/c1-11-9-12(20(14,17)18)3-4-13(11)19-8-2-6-16-7-5-15-10-16/h3-5,7,9-10H,2,6,8H2,1H3 |
| InChIKey | ZIMYKNBKFZWFNY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|