C13H15ClN2O3S — CID 82909719
4-(2-imidazol-1-ylethoxy)-2,3-dimethylbenzenesulfonyl chloride (PubChem CID 82909719) has the molecular formula C13H15ClN2O3S and a molecular weight of 314.79 g/mol. Its IUPAC name is 4-(2-imidazol-1-ylethoxy)-2,3-dimethylbenzenesulfonyl chloride.
| Compound Name | 4-(2-imidazol-1-ylethoxy)-2,3-dimethylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82909719 |
| Molecular Formula | C13H15ClN2O3S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 4-(2-imidazol-1-ylethoxy)-2,3-dimethylbenzenesulfonyl chloride |
| SMILES | Cc1c(OCCn2ccnc2)ccc(S(=O)(=O)Cl)c1C |
| InChI | InChI=1S/C13H15ClN2O3S/c1-10-11(2)13(20(14,17)18)4-3-12(10)19-8-7-16-6-5-15-9-16/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | SEOGJDXTDGRCIE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |