C13H16ClNO3S — CID 82909968
4-(4-cyanobutoxy)-2,3-dimethylbenzenesulfonyl chloride (PubChem CID 82909968) has the molecular formula C13H16ClNO3S and a molecular weight of 301.80 g/mol. Its IUPAC name is 4-(4-cyanobutoxy)-2,3-dimethylbenzenesulfonyl chloride.
| Compound Name | 4-(4-cyanobutoxy)-2,3-dimethylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82909968 |
| Molecular Formula | C13H16ClNO3S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 4-(4-cyanobutoxy)-2,3-dimethylbenzenesulfonyl chloride |
| SMILES | Cc1c(OCCCCC#N)ccc(S(=O)(=O)Cl)c1C |
| InChI | InChI=1S/C13H16ClNO3S/c1-10-11(2)13(19(14,16)17)7-6-12(10)18-9-5-3-4-8-15/h6-7H,3-5,9H2,1-2H3 |
| InChIKey | LYDYYUMYHOZJEJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|