C13H19ClO3S — CID 107889725
2,3-dimethyl-4-pentan-2-yloxybenzenesulfonyl chloride (PubChem CID 107889725) has the molecular formula C13H19ClO3S and a molecular weight of 290.81 g/mol. Its IUPAC name is 2,3-dimethyl-4-pentan-2-yloxybenzenesulfonyl chloride.
| Compound Name | 2,3-dimethyl-4-pentan-2-yloxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 107889725 |
| Molecular Formula | C13H19ClO3S |
| Molecular Weight | 290.81 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2,3-dimethyl-4-pentan-2-yloxybenzenesulfonyl chloride |
| SMILES | CCCC(C)Oc1ccc(S(=O)(=O)Cl)c(C)c1C |
| InChI | InChI=1S/C13H19ClO3S/c1-5-6-9(2)17-12-7-8-13(18(14,15)16)11(4)10(12)3/h7-9H,5-6H2,1-4H3 |
| InChIKey | IHNXIMYJLZMJTF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.81 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |