C15H25NO3S — CID 114013779
3-tert-butyl-4-pentan-2-yloxybenzenesulfonamide (PubChem CID 114013779) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 3-tert-butyl-4-pentan-2-yloxybenzenesulfonamide.
| Compound Name | 3-tert-butyl-4-pentan-2-yloxybenzenesulfonamide |
|---|---|
| PubChem CID | 114013779 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 3-tert-butyl-4-pentan-2-yloxybenzenesulfonamide |
| SMILES | CCCC(C)Oc1ccc(S(N)(=O)=O)cc1C(C)(C)C |
| InChI | InChI=1S/C15H25NO3S/c1-6-7-11(2)19-14-9-8-12(20(16,17)18)10-13(14)15(3,4)5/h8-11H,6-7H2,1-5H3,(H2,16,17,18) |
| InChIKey | XIQZBLVKAISXKE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |