C16H22BrNO — CID 63217440
1-(4-bromophenyl)-4-(2,2-dimethylpyrrolidin-1-yl)butan-1-one (PubChem CID 63217440) has the molecular formula C16H22BrNO and a molecular weight of 324.26 g/mol. Its IUPAC name is 1-(4-bromophenyl)-4-(2,2-dimethylpyrrolidin-1-yl)butan-1-one.
| Compound Name | 1-(4-bromophenyl)-4-(2,2-dimethylpyrrolidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 63217440 |
| Molecular Formula | C16H22BrNO |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1-(4-bromophenyl)-4-(2,2-dimethylpyrrolidin-1-yl)butan-1-one |
| SMILES | CC1(C)CCCN1CCCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H22BrNO/c1-16(2)10-4-12-18(16)11-3-5-15(19)13-6-8-14(17)9-7-13/h6-9H,3-5,10-12H2,1-2H3 |
| InChIKey | XXHAQNXVXNCMLL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |