C13H18N4O — CID 63222153
N-(4-aminophenyl)-2-[1-cyanopropan-2-yl(methyl)amino]acetamide (PubChem CID 63222153) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is N-(4-aminophenyl)-2-[1-cyanopropan-2-yl(methyl)amino]acetamide.
| Compound Name | N-(4-aminophenyl)-2-[1-cyanopropan-2-yl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 63222153 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | N-(4-aminophenyl)-2-[1-cyanopropan-2-yl(methyl)amino]acetamide |
| SMILES | CC(CC#N)N(C)CC(=O)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C13H18N4O/c1-10(7-8-14)17(2)9-13(18)16-12-5-3-11(15)4-6-12/h3-6,10H,7,9,15H2,1-2H3,(H,16,18) |
| InChIKey | XIAZNZCEUAWQQY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|